C27H58O10Si2 — CID 58695535
2,3-bis(3-triethoxysilylpropoxy)propyl 2,2-dimethylbutanoate (PubChem CID 58695535) has the molecular formula C27H58O10Si2 and a molecular weight of 598.92 g/mol. Its IUPAC name is 2,3-bis(3-triethoxysilylpropoxy)propyl 2,2-dimethylbutanoate.
| Compound Name | 2,3-bis(3-triethoxysilylpropoxy)propyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58695535 |
| Molecular Formula | C27H58O10Si2 |
| Molecular Weight | 598.92 g/mol |
| Exact Mass | 598.36 |
| IUPAC Name | 2,3-bis(3-triethoxysilylpropoxy)propyl 2,2-dimethylbutanoate |
| SMILES | CCO[Si](CCCOCC(COC(=O)C(C)(C)CC)OCCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C27H58O10Si2/c1-10-27(8,9)26(28)31-24-25(30-20-18-22-39(35-14-5,36-15-6)37-16-7)23-29-19-17-21-38(32-11-2,33-12-3)34-13-4/h25H,10-24H2,1-9H3 |
| InChIKey | FLEJRKRMDAUAND-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.92 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|