C18H41NO5Si — CID 144747222
3-amino-4-methyl-3-propan-2-yl-1-(3-triethoxysilylpropoxy)pentan-2-ol (PubChem CID 144747222) has the molecular formula C18H41NO5Si and a molecular weight of 379.61 g/mol. Its IUPAC name is 3-amino-4-methyl-3-propan-2-yl-1-(3-triethoxysilylpropoxy)pentan-2-ol.
| Compound Name | 3-amino-4-methyl-3-propan-2-yl-1-(3-triethoxysilylpropoxy)pentan-2-ol |
|---|---|
| PubChem CID | 144747222 |
| Molecular Formula | C18H41NO5Si |
| Molecular Weight | 379.61 g/mol |
| Exact Mass | 379.28 |
| IUPAC Name | 3-amino-4-methyl-3-propan-2-yl-1-(3-triethoxysilylpropoxy)pentan-2-ol |
| SMILES | CCO[Si](CCCOCC(O)C(N)(C(C)C)C(C)C)(OCC)OCC |
| InChI | InChI=1S/C18H41NO5Si/c1-8-22-25(23-9-2,24-10-3)13-11-12-21-14-17(20)18(19,15(4)5)16(6)7/h15-17,20H,8-14,19H2,1-7H3 |
| InChIKey | FVEQSTHCDYMVLW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.61 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|