C35H82O14Si4 — CID 160651354
3-[1-[3-[dimethoxy(methyl)silyl]propoxy]propan-2-yloxy]propyl-dimethoxy-methylsilane;triethoxy-[3-[2-(3-triethoxysilylpropoxy)ethoxy]propyl]silane (PubChem CID 160651354) has the molecular formula C35H82O14Si4 and a molecular weight of 839.37 g/mol. Its IUPAC name is 3-[1-[3-[dimethoxy(methyl)silyl]propoxy]propan-2-yloxy]propyl-dimethoxy-methylsilane;triethoxy-[3-[2-(3-triethoxysilylpropoxy)ethoxy]propyl]silane.
| Compound Name | 3-[1-[3-[dimethoxy(methyl)silyl]propoxy]propan-2-yloxy]propyl-dimethoxy-methylsilane;triethoxy-[3-[2-(3-triethoxysilylpropoxy)ethoxy]propyl]silane |
|---|---|
| PubChem CID | 160651354 |
| Molecular Formula | C35H82O14Si4 |
| Molecular Weight | 839.37 g/mol |
| Exact Mass | 838.48 |
| IUPAC Name | 3-[1-[3-[dimethoxy(methyl)silyl]propoxy]propan-2-yloxy]propyl-dimethoxy-methylsilane;triethoxy-[3-[2-(3-triethoxysilylpropoxy)ethoxy]propyl]silane |
| SMILES | CCO[Si](CCCOCCOCCC[Si](OCC)(OCC)OCC)(OCC)OCC.CO[Si](C)(CCCOCC(C)OCCC[Si](C)(OC)OC)OC |
| InChI | InChI=1S/C20H46O8Si2.C15H36O6Si2/c1-7-23-29(24-8-2,25-9-3)19-13-15-21-17-18-22-16-14-20-30(26-10-4,27-11-5)28-12-6;1-15(21-11-9-13-23(7,18-4)19-5)14-20-10-8-12-22(6,16-2)17-3/h7-20H2,1-6H3;15H,8-14H2,1-7H3 |
| InChIKey | RKLQKWJSWTWQAG-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 129.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.37 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|