C11H28O18S4Si2 — CID 153456865
[methyl-[3-[1-[3-[methyl(disulfooxy)silyl]propoxy]propan-2-yloxy]propyl]-sulfooxysilyl] hydrogen sulfate (PubChem CID 153456865) has the molecular formula C11H28O18S4Si2 and a molecular weight of 632.77 g/mol. Its IUPAC name is [methyl-[3-[1-[3-[methyl(disulfooxy)silyl]propoxy]propan-2-yloxy]propyl]-sulfooxysilyl] hydrogen sulfate.
| Compound Name | [methyl-[3-[1-[3-[methyl(disulfooxy)silyl]propoxy]propan-2-yloxy]propyl]-sulfooxysilyl] hydrogen sulfate |
|---|---|
| PubChem CID | 153456865 |
| Molecular Formula | C11H28O18S4Si2 |
| Molecular Weight | 632.77 g/mol |
| Exact Mass | 631.97 |
| IUPAC Name | [methyl-[3-[1-[3-[methyl(disulfooxy)silyl]propoxy]propan-2-yloxy]propyl]-sulfooxysilyl] hydrogen sulfate |
| SMILES | CC(COCCC[Si](C)(OS(=O)(=O)O)OS(=O)(=O)O)OCCC[Si](C)(OS(=O)(=O)O)OS(=O)(=O)O |
| InChI | InChI=1S/C11H28O18S4Si2/c1-11(25-7-5-9-35(3,28-32(18,19)20)29-33(21,22)23)10-24-6-4-8-34(2,26-30(12,13)14)27-31(15,16)17/h11H,4-10H2,1-3H3,(H,12,13,14)(H,15,16,17)(H,18,19,20)(H,21,22,23) |
| InChIKey | UFTJFBBBVOUPNO-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 272.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.77 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|