C11H24O7S — CID 58663428
4-[2-[2-(2-hydroxyethoxy)propoxy]ethoxy]butane-1-sulfonic acid (PubChem CID 58663428) has the molecular formula C11H24O7S and a molecular weight of 300.37 g/mol. Its IUPAC name is 4-[2-[2-(2-hydroxyethoxy)propoxy]ethoxy]butane-1-sulfonic acid.
| Compound Name | 4-[2-[2-(2-hydroxyethoxy)propoxy]ethoxy]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 58663428 |
| Molecular Formula | C11H24O7S |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 4-[2-[2-(2-hydroxyethoxy)propoxy]ethoxy]butane-1-sulfonic acid |
| SMILES | CC(COCCOCCCCS(=O)(=O)O)OCCO |
| InChI | InChI=1S/C11H24O7S/c1-11(18-6-4-12)10-17-8-7-16-5-2-3-9-19(13,14)15/h11-12H,2-10H2,1H3,(H,13,14,15) |
| InChIKey | ZPPOVZXIWCNSHH-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|