C11H28O7Si — CID 141037830
3-(2-triethoxysilylethoxy)propane-1,2-diol;hydrate (PubChem CID 141037830) has the molecular formula C11H28O7Si and a molecular weight of 300.42 g/mol. Its IUPAC name is 3-(2-triethoxysilylethoxy)propane-1,2-diol;hydrate.
| Compound Name | 3-(2-triethoxysilylethoxy)propane-1,2-diol;hydrate |
|---|---|
| PubChem CID | 141037830 |
| Molecular Formula | C11H28O7Si |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 3-(2-triethoxysilylethoxy)propane-1,2-diol;hydrate |
| SMILES | CCO[Si](CCOCC(O)CO)(OCC)OCC.O |
| InChI | InChI=1S/C11H26O6Si.H2O/c1-4-15-18(16-5-2,17-6-3)8-7-14-10-11(13)9-12;/h11-13H,4-10H2,1-3H3;1H2 |
| InChIKey | XTFBZXHMAWMSBY-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|