C41H68O10S2Si2 — CID 59620724
[4-[2-[4-[2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoyl]oxyphenyl]propan-2-yl]phenyl] 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate (PubChem CID 59620724) has the molecular formula C41H68O10S2Si2 and a molecular weight of 841.29 g/mol. Its IUPAC name is [4-[2-[4-[2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoyl]oxyphenyl]propan-2-yl]phenyl] 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate.
| Compound Name | [4-[2-[4-[2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoyl]oxyphenyl]propan-2-yl]phenyl] 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate |
|---|---|
| PubChem CID | 59620724 |
| Molecular Formula | C41H68O10S2Si2 |
| Molecular Weight | 841.29 g/mol |
| Exact Mass | 840.38 |
| IUPAC Name | [4-[2-[4-[2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoyl]oxyphenyl]propan-2-yl]phenyl] 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate |
| SMILES | CCO[Si](CCCSC(C)(C)C(=O)Oc1ccc(C(C)(C)c2ccc(OC(=O)C(C)(C)SCCC[Si](OCC)(OCC)OCC)cc2)cc1)(OCC)OCC |
| InChI | InChI=1S/C41H68O10S2Si2/c1-13-44-54(45-14-2,46-15-3)31-19-29-52-40(9,10)37(42)50-35-25-21-33(22-26-35)39(7,8)34-23-27-36(28-24-34)51-38(43)41(11,12)53-30-20-32-55(47-16-4,48-17-5)49-18-6/h21-28H,13-20,29-32H2,1-12H3 |
| InChIKey | BJAFOQQECJSIOW-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.29 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|