C28H40O3 — CID 138525295
[4-[2-[4-(3-methylhexan-3-yloxy)phenyl]propan-2-yl]phenyl] 2,2-dimethylbutanoate (PubChem CID 138525295) has the molecular formula C28H40O3 and a molecular weight of 424.63 g/mol. Its IUPAC name is [4-[2-[4-(3-methylhexan-3-yloxy)phenyl]propan-2-yl]phenyl] 2,2-dimethylbutanoate.
| Compound Name | [4-[2-[4-(3-methylhexan-3-yloxy)phenyl]propan-2-yl]phenyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 138525295 |
| Molecular Formula | C28H40O3 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | [4-[2-[4-(3-methylhexan-3-yloxy)phenyl]propan-2-yl]phenyl] 2,2-dimethylbutanoate |
| SMILES | CCCC(C)(CC)Oc1ccc(C(C)(C)c2ccc(OC(=O)C(C)(C)CC)cc2)cc1 |
| InChI | InChI=1S/C28H40O3/c1-9-20-28(8,11-3)31-24-18-14-22(15-19-24)27(6,7)21-12-16-23(17-13-21)30-25(29)26(4,5)10-2/h12-19H,9-11,20H2,1-8H3 |
| InChIKey | KIHQIKHWCZOEQE-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|