C31H44O5 — CID 89075645
propan-2-yl 2-(2,2-dimethylbutanoyloxy)-5-[2-[4-(3-methylpentan-3-yloxy)phenyl]propan-2-yl]benzoate (PubChem CID 89075645) has the molecular formula C31H44O5 and a molecular weight of 496.69 g/mol. Its IUPAC name is propan-2-yl 2-(2,2-dimethylbutanoyloxy)-5-[2-[4-(3-methylpentan-3-yloxy)phenyl]propan-2-yl]benzoate.
| Compound Name | propan-2-yl 2-(2,2-dimethylbutanoyloxy)-5-[2-[4-(3-methylpentan-3-yloxy)phenyl]propan-2-yl]benzoate |
|---|---|
| PubChem CID | 89075645 |
| Molecular Formula | C31H44O5 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | propan-2-yl 2-(2,2-dimethylbutanoyloxy)-5-[2-[4-(3-methylpentan-3-yloxy)phenyl]propan-2-yl]benzoate |
| SMILES | CCC(C)(CC)Oc1ccc(C(C)(C)c2ccc(OC(=O)C(C)(C)CC)c(C(=O)OC(C)C)c2)cc1 |
| InChI | InChI=1S/C31H44O5/c1-11-29(6,7)28(33)35-26-19-16-23(20-25(26)27(32)34-21(4)5)30(8,9)22-14-17-24(18-15-22)36-31(10,12-2)13-3/h14-21H,11-13H2,1-10H3 |
| InChIKey | KHIQJTWOARZJSL-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|