C22H30O3 — CID 89379419
[4-(3-methylpentan-3-yloxy)naphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 89379419) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is [4-(3-methylpentan-3-yloxy)naphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [4-(3-methylpentan-3-yloxy)naphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 89379419 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | [4-(3-methylpentan-3-yloxy)naphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(CC)Oc1ccc(OC(=O)C(C)(C)CC)c2ccccc12 |
| InChI | InChI=1S/C22H30O3/c1-7-21(4,5)20(23)24-18-14-15-19(25-22(6,8-2)9-3)17-13-11-10-12-16(17)18/h10-15H,7-9H2,1-6H3 |
| InChIKey | GBWKOPXNFDFVRW-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|