C26H28O3 — CID 25229098
[1-(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)naphthalen-2-yl] 2,2-dimethylbutanoate (PubChem CID 25229098) has the molecular formula C26H28O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is [1-(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)naphthalen-2-yl] 2,2-dimethylbutanoate.
| Compound Name | [1-(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)naphthalen-2-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 25229098 |
| Molecular Formula | C26H28O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | [1-(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)naphthalen-2-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1ccc2ccccc2c1-c1c(O)ccc2c1CCCC2 |
| InChI | InChI=1S/C26H28O3/c1-4-26(2,3)25(28)29-22-16-14-18-10-6-8-12-20(18)24(22)23-19-11-7-5-9-17(19)13-15-21(23)27/h6,8,10,12-16,27H,4-5,7,9,11H2,1-3H3 |
| InChIKey | GFIMBYGMLBMHHY-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|