C22H28O3 — CID 121387882
[4-(1-hydroxycyclohexyl)naphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 121387882) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is [4-(1-hydroxycyclohexyl)naphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [4-(1-hydroxycyclohexyl)naphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 121387882 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | [4-(1-hydroxycyclohexyl)naphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1ccc(C2(O)CCCCC2)c2ccccc12 |
| InChI | InChI=1S/C22H28O3/c1-4-21(2,3)20(23)25-19-13-12-18(16-10-6-7-11-17(16)19)22(24)14-8-5-9-15-22/h6-7,10-13,24H,4-5,8-9,14-15H2,1-3H3 |
| InChIKey | DGYCDEKFAMAOOR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|