C34H32O12 — CID 54509493
(3,6,7,10,11-pentaacetyloxytriphenylen-2-yl) 2,2-dimethylbutanoate (PubChem CID 54509493) has the molecular formula C34H32O12 and a molecular weight of 632.62 g/mol. Its IUPAC name is (3,6,7,10,11-pentaacetyloxytriphenylen-2-yl) 2,2-dimethylbutanoate.
| Compound Name | (3,6,7,10,11-pentaacetyloxytriphenylen-2-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 54509493 |
| Molecular Formula | C34H32O12 |
| Molecular Weight | 632.62 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | (3,6,7,10,11-pentaacetyloxytriphenylen-2-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1cc2c3cc(OC(C)=O)c(OC(C)=O)cc3c3cc(OC(C)=O)c(OC(C)=O)cc3c2cc1OC(C)=O |
| InChI | InChI=1S/C34H32O12/c1-9-34(7,8)33(40)46-32-15-26-24-13-30(44-19(5)38)28(42-17(3)36)11-22(24)21-10-27(41-16(2)35)29(43-18(4)37)12-23(21)25(26)14-31(32)45-20(6)39/h10-15H,9H2,1-8H3 |
| InChIKey | YICOEQUTZGNHOP-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.62 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|