C20H32O2 — CID 90306744
(3,5-ditert-butylphenyl) 2,2-dimethylbutanoate (PubChem CID 90306744) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (3,5-ditert-butylphenyl) 2,2-dimethylbutanoate.
| Compound Name | (3,5-ditert-butylphenyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 90306744 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (3,5-ditert-butylphenyl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H32O2/c1-10-20(8,9)17(21)22-16-12-14(18(2,3)4)11-15(13-16)19(5,6)7/h11-13H,10H2,1-9H3 |
| InChIKey | AFEBXBZYCOWMEP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|