C17H24O4 — CID 20771677
tert-butyl 4-(2,2-dimethylbutanoyloxy)benzoate (PubChem CID 20771677) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is tert-butyl 4-(2,2-dimethylbutanoyloxy)benzoate.
| Compound Name | tert-butyl 4-(2,2-dimethylbutanoyloxy)benzoate |
|---|---|
| PubChem CID | 20771677 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | tert-butyl 4-(2,2-dimethylbutanoyloxy)benzoate |
| SMILES | CCC(C)(C)C(=O)Oc1ccc(C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H24O4/c1-7-17(5,6)15(19)20-13-10-8-12(9-11-13)14(18)21-16(2,3)4/h8-11H,7H2,1-6H3 |
| InChIKey | IRSFGLJUQFMDRH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|