C29H51NO4 — CID 90892831
4-(2,2-dimethylbutanoyloxy)benzoate;tetrabutylazanium (PubChem CID 90892831) has the molecular formula C29H51NO4 and a molecular weight of 477.73 g/mol. Its IUPAC name is 4-(2,2-dimethylbutanoyloxy)benzoate;tetrabutylazanium.
| Compound Name | 4-(2,2-dimethylbutanoyloxy)benzoate;tetrabutylazanium |
|---|---|
| PubChem CID | 90892831 |
| Molecular Formula | C29H51NO4 |
| Molecular Weight | 477.73 g/mol |
| Exact Mass | 477.38 |
| IUPAC Name | 4-(2,2-dimethylbutanoyloxy)benzoate;tetrabutylazanium |
| SMILES | CCC(C)(C)C(=O)Oc1ccc(C(=O)[O-])cc1.CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H36N.C13H16O4/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-4-13(2,3)12(16)17-10-7-5-9(6-8-10)11(14)15/h5-16H2,1-4H3;5-8H,4H2,1-3H3,(H,14,15)/q+1;/p-1 |
| InChIKey | AXOKWUCJAZZIBA-UHFFFAOYSA-M |
| XLogP | 6.40 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.73 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|