C42H69NO5S — CID 159568803
4-(4-carboxyphenyl)sulfinylbenzoate;tetraheptylazanium (PubChem CID 159568803) has the molecular formula C42H69NO5S and a molecular weight of 700.08 g/mol. Its IUPAC name is 4-(4-carboxyphenyl)sulfinylbenzoate;tetraheptylazanium.
| Compound Name | 4-(4-carboxyphenyl)sulfinylbenzoate;tetraheptylazanium |
|---|---|
| PubChem CID | 159568803 |
| Molecular Formula | C42H69NO5S |
| Molecular Weight | 700.08 g/mol |
| Exact Mass | 699.49 |
| IUPAC Name | 4-(4-carboxyphenyl)sulfinylbenzoate;tetraheptylazanium |
| SMILES | CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC.O=C([O-])c1ccc(S(=O)c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C28H60N.C14H10O5S/c1-5-9-13-17-21-25-29(26-22-18-14-10-6-2,27-23-19-15-11-7-3)28-24-20-16-12-8-4;15-13(16)9-1-5-11(6-2-9)20(19)12-7-3-10(4-8-12)14(17)18/h5-28H2,1-4H3;1-8H,(H,15,16)(H,17,18)/q+1;/p-1 |
| InChIKey | MHNYNXHRLQJWIZ-UHFFFAOYSA-M |
| XLogP | 10.60 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.08 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|