C30H45NO4S2 — CID 139744999
4-[(4-carboxyphenyl)disulfanyl]benzoate;tetrabutylazanium (PubChem CID 139744999) has the molecular formula C30H45NO4S2 and a molecular weight of 547.83 g/mol. Its IUPAC name is 4-[(4-carboxyphenyl)disulfanyl]benzoate;tetrabutylazanium.
| Compound Name | 4-[(4-carboxyphenyl)disulfanyl]benzoate;tetrabutylazanium |
|---|---|
| PubChem CID | 139744999 |
| Molecular Formula | C30H45NO4S2 |
| Molecular Weight | 547.83 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | 4-[(4-carboxyphenyl)disulfanyl]benzoate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=C([O-])c1ccc(SSc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C16H36N.C14H10O4S2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;15-13(16)9-1-5-11(6-2-9)19-20-12-7-3-10(4-8-12)14(17)18/h5-16H2,1-4H3;1-8H,(H,15,16)(H,17,18)/q+1;/p-1 |
| InChIKey | FMGFVSBRRSXOQN-UHFFFAOYSA-M |
| XLogP | 7.55 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.83 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|