C42H70NO6S+ — CID 67856178
4-(4-carboxyphenyl)sulfonylbenzoic acid;tetraheptylazanium (PubChem CID 67856178) has the molecular formula C42H70NO6S+ and a molecular weight of 717.09 g/mol. Its IUPAC name is 4-(4-carboxyphenyl)sulfonylbenzoic acid;tetraheptylazanium.
| Compound Name | 4-(4-carboxyphenyl)sulfonylbenzoic acid;tetraheptylazanium |
|---|---|
| PubChem CID | 67856178 |
| Molecular Formula | C42H70NO6S+ |
| Molecular Weight | 717.09 g/mol |
| Exact Mass | 716.49 |
| IUPAC Name | 4-(4-carboxyphenyl)sulfonylbenzoic acid;tetraheptylazanium |
| SMILES | CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC.O=C(O)c1ccc(S(=O)(=O)c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C28H60N.C14H10O6S/c1-5-9-13-17-21-25-29(26-22-18-14-10-6-2,27-23-19-15-11-7-3)28-24-20-16-12-8-4;15-13(16)9-1-5-11(6-2-9)21(19,20)12-7-3-10(4-8-12)14(17)18/h5-28H2,1-4H3;1-8H,(H,15,16)(H,17,18)/q+1; |
| InChIKey | ZRHFPLWSBLGVNN-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.09 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|