C34H53NO6S — CID 139912052
4-(4-carboxyphenyl)sulfonylbenzoate;tetrapentylazanium (PubChem CID 139912052) has the molecular formula C34H53NO6S and a molecular weight of 603.87 g/mol. Its IUPAC name is 4-(4-carboxyphenyl)sulfonylbenzoate;tetrapentylazanium.
| Compound Name | 4-(4-carboxyphenyl)sulfonylbenzoate;tetrapentylazanium |
|---|---|
| PubChem CID | 139912052 |
| Molecular Formula | C34H53NO6S |
| Molecular Weight | 603.87 g/mol |
| Exact Mass | 603.36 |
| IUPAC Name | 4-(4-carboxyphenyl)sulfonylbenzoate;tetrapentylazanium |
| SMILES | CCCCC[N+](CCCCC)(CCCCC)CCCCC.O=C([O-])c1ccc(S(=O)(=O)c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H44N.C14H10O6S/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;15-13(16)9-1-5-11(6-2-9)21(19,20)12-7-3-10(4-8-12)14(17)18/h5-20H2,1-4H3;1-8H,(H,15,16)(H,17,18)/q+1;/p-1 |
| InChIKey | KKRBXABKOQMIEW-UHFFFAOYSA-M |
| XLogP | 7.15 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.87 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|