About 4-methylbenzoate;tetrabutylazanium
4-methylbenzoate;tetrabutylazanium (PubChem CID 66598661) has the molecular formula C24H43NO2
and a molecular weight of 377.61 g/mol. Its IUPAC name is 4-methylbenzoate;tetrabutylazanium.
Molecular Properties
| Compound Name | 4-methylbenzoate;tetrabutylazanium |
| PubChem CID | 66598661 |
| Molecular Formula | C24H43NO2 |
| Molecular Weight | 377.61 g/mol |
| Exact Mass | 377.33 |
| IUPAC Name | 4-methylbenzoate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.Cc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C16H36N.C8H8O2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-6-2-4-7(5-3-6)8(9)10/h5-16H2,1-4H3;2-5H,1H3,(H,9,10)/q+1;/p-1 |
| InChIKey | GZJMTMGZQWJFPM-UHFFFAOYSA-M |
| XLogP | 5.36 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.61 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzoate;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzoate;tetrabutylazanium?
The IUPAC name of 4-methylbenzoate;tetrabutylazanium (CID 66598661) is 4-methylbenzoate;tetrabutylazanium.
What is the SMILES notation for 4-methylbenzoate;tetrabutylazanium?
The canonical SMILES for 4-methylbenzoate;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.Cc1ccc(C(=O)[O-])cc1.
What is the InChIKey of 4-methylbenzoate;tetrabutylazanium?
The InChIKey is GZJMTMGZQWJFPM-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.C8H8O2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-6-2-4-7(5-3-6)8(9)10/h5-16H2,1-4H3;2-5H,1H3,(H,9,10)/q+1;/p-1.
What are the key properties of 4-methylbenzoate;tetrabutylazanium?
4-methylbenzoate;tetrabutylazanium has a molecular weight of 377.61 g/mol, XLogP of 5.36, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzoate;tetrabutylazanium is sourced from PubChem (CID 66598661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).