About azanium 4-methylbenzoate
azanium 4-methylbenzoate (PubChem CID 67114247) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is azanium 4-methylbenzoate.
Molecular Properties
| Compound Name | azanium 4-methylbenzoate |
| PubChem CID | 67114247 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | azanium 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)[O-])cc1.[NH4+] |
| InChI | InChI=1S/C8H8O2.H3N/c1-6-2-4-7(5-3-6)8(9)10;/h2-5H,1H3,(H,9,10);1H3 |
| InChIKey | QEKVDZFCDPZCLP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azanium 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 4-methylbenzoate?
The IUPAC name of azanium 4-methylbenzoate (CID 67114247) is azanium 4-methylbenzoate.
What is the SMILES notation for azanium 4-methylbenzoate?
The canonical SMILES for azanium 4-methylbenzoate is Cc1ccc(C(=O)[O-])cc1.[NH4+].
What is the InChIKey of azanium 4-methylbenzoate?
The InChIKey is QEKVDZFCDPZCLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.H3N/c1-6-2-4-7(5-3-6)8(9)10;/h2-5H,1H3,(H,9,10);1H3.
What are the key properties of azanium 4-methylbenzoate?
azanium 4-methylbenzoate has a molecular weight of 153.18 g/mol, XLogP of 0.73, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 4-methylbenzoate is sourced from PubChem (CID 67114247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).