About disodium;4-(4-carboxylatophenyl)benzoate;hydrate
disodium;4-(4-carboxylatophenyl)benzoate;hydrate (PubChem CID 139638237) has the molecular formula C14H10Na2O5
and a molecular weight of 304.21 g/mol. Its IUPAC name is disodium;4-(4-carboxylatophenyl)benzoate;hydrate.
Molecular Properties
| Compound Name | disodium;4-(4-carboxylatophenyl)benzoate;hydrate |
| PubChem CID | 139638237 |
| Molecular Formula | C14H10Na2O5 |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | disodium;4-(4-carboxylatophenyl)benzoate;hydrate |
| SMILES | O.O=C([O-])c1ccc(-c2ccc(C(=O)[O-])cc2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C14H10O4.2Na.H2O/c15-13(16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(17)18;;;/h1-8H,(H,15,16)(H,17,18);;;1H2/q;2*+1;/p-2 |
| InChIKey | FCQIVXVNWZHZJD-UHFFFAOYSA-L |
| XLogP | -6.74 |
| TPSA | 111.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | -6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze disodium;4-(4-carboxylatophenyl)benzoate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;4-(4-carboxylatophenyl)benzoate;hydrate?
The IUPAC name of disodium;4-(4-carboxylatophenyl)benzoate;hydrate (CID 139638237) is disodium;4-(4-carboxylatophenyl)benzoate;hydrate.
What is the SMILES notation for disodium;4-(4-carboxylatophenyl)benzoate;hydrate?
The canonical SMILES for disodium;4-(4-carboxylatophenyl)benzoate;hydrate is O.O=C([O-])c1ccc(-c2ccc(C(=O)[O-])cc2)cc1.[Na+].[Na+].
What is the InChIKey of disodium;4-(4-carboxylatophenyl)benzoate;hydrate?
The InChIKey is FCQIVXVNWZHZJD-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H10O4.2Na.H2O/c15-13(16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(17)18;;;/h1-8H,(H,15,16)(H,17,18);;;1H2/q;2*+1;/p-2.
What are the key properties of disodium;4-(4-carboxylatophenyl)benzoate;hydrate?
disodium;4-(4-carboxylatophenyl)benzoate;hydrate has a molecular weight of 304.21 g/mol, XLogP of -6.74, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;4-(4-carboxylatophenyl)benzoate;hydrate is sourced from PubChem (CID 139638237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).