About 6-azaniumylhexylazanium;4-(4-carboxylatophenyl)benzoate
6-azaniumylhexylazanium;4-(4-carboxylatophenyl)benzoate (PubChem CID 139686733) has the molecular formula C20H26N2O4
and a molecular weight of 358.44 g/mol. Its IUPAC name is 6-azaniumylhexylazanium;4-(4-carboxylatophenyl)benzoate.
Molecular Properties
| Compound Name | 6-azaniumylhexylazanium;4-(4-carboxylatophenyl)benzoate |
| PubChem CID | 139686733 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 6-azaniumylhexylazanium;4-(4-carboxylatophenyl)benzoate |
| SMILES | O=C([O-])c1ccc(-c2ccc(C(=O)[O-])cc2)cc1.[NH3+]CCCCCC[NH3+] |
| InChI | InChI=1S/C14H10O4.C6H16N2/c15-13(16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(17)18;7-5-3-1-2-4-6-8/h1-8H,(H,15,16)(H,17,18);1-8H2 |
| InChIKey | NFHBBAKMVRNGOR-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-azaniumylhexylazanium;4-(4-carboxylatophenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azaniumylhexylazanium;4-(4-carboxylatophenyl)benzoate?
The IUPAC name of 6-azaniumylhexylazanium;4-(4-carboxylatophenyl)benzoate (CID 139686733) is 6-azaniumylhexylazanium;4-(4-carboxylatophenyl)benzoate.
What is the SMILES notation for 6-azaniumylhexylazanium;4-(4-carboxylatophenyl)benzoate?
The canonical SMILES for 6-azaniumylhexylazanium;4-(4-carboxylatophenyl)benzoate is O=C([O-])c1ccc(-c2ccc(C(=O)[O-])cc2)cc1.[NH3+]CCCCCC[NH3+].
What is the InChIKey of 6-azaniumylhexylazanium;4-(4-carboxylatophenyl)benzoate?
The InChIKey is NFHBBAKMVRNGOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O4.C6H16N2/c15-13(16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(17)18;7-5-3-1-2-4-6-8/h1-8H,(H,15,16)(H,17,18);1-8H2.
What are the key properties of 6-azaniumylhexylazanium;4-(4-carboxylatophenyl)benzoate?
6-azaniumylhexylazanium;4-(4-carboxylatophenyl)benzoate has a molecular weight of 358.44 g/mol, XLogP of -0.89, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azaniumylhexylazanium;4-(4-carboxylatophenyl)benzoate is sourced from PubChem (CID 139686733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).