About dodecylazanium;4-hexoxybenzoate
dodecylazanium;4-hexoxybenzoate (PubChem CID 141267494) has the molecular formula C25H45NO3
and a molecular weight of 407.64 g/mol. Its IUPAC name is dodecylazanium;4-hexoxybenzoate.
Molecular Properties
| Compound Name | dodecylazanium;4-hexoxybenzoate |
| PubChem CID | 141267494 |
| Molecular Formula | C25H45NO3 |
| Molecular Weight | 407.64 g/mol |
| Exact Mass | 407.34 |
| IUPAC Name | dodecylazanium;4-hexoxybenzoate |
| SMILES | CCCCCCCCCCCC[NH3+].CCCCCCOc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C13H18O3.C12H27N/c1-2-3-4-5-10-16-12-8-6-11(7-9-12)13(14)15;1-2-3-4-5-6-7-8-9-10-11-12-13/h6-9H,2-5,10H2,1H3,(H,14,15);2-13H2,1H3 |
| InChIKey | IPMGEYLZRQPRJS-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.64 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodecylazanium;4-hexoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecylazanium;4-hexoxybenzoate?
The IUPAC name of dodecylazanium;4-hexoxybenzoate (CID 141267494) is dodecylazanium;4-hexoxybenzoate.
What is the SMILES notation for dodecylazanium;4-hexoxybenzoate?
The canonical SMILES for dodecylazanium;4-hexoxybenzoate is CCCCCCCCCCCC[NH3+].CCCCCCOc1ccc(C(=O)[O-])cc1.
What is the InChIKey of dodecylazanium;4-hexoxybenzoate?
The InChIKey is IPMGEYLZRQPRJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3.C12H27N/c1-2-3-4-5-10-16-12-8-6-11(7-9-12)13(14)15;1-2-3-4-5-6-7-8-9-10-11-12-13/h6-9H,2-5,10H2,1H3,(H,14,15);2-13H2,1H3.
What are the key properties of dodecylazanium;4-hexoxybenzoate?
dodecylazanium;4-hexoxybenzoate has a molecular weight of 407.64 g/mol, XLogP of 5.16, 17 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dodecylazanium;4-hexoxybenzoate is sourced from PubChem (CID 141267494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).