C27H49NO3 — CID 162085634
decyl-ethyl-dimethylazanium;4-hexoxybenzoate (PubChem CID 162085634) has the molecular formula C27H49NO3 and a molecular weight of 435.69 g/mol. Its IUPAC name is decyl-ethyl-dimethylazanium;4-hexoxybenzoate.
| Compound Name | decyl-ethyl-dimethylazanium;4-hexoxybenzoate |
|---|---|
| PubChem CID | 162085634 |
| Molecular Formula | C27H49NO3 |
| Molecular Weight | 435.69 g/mol |
| Exact Mass | 435.37 |
| IUPAC Name | decyl-ethyl-dimethylazanium;4-hexoxybenzoate |
| SMILES | CCCCCCCCCC[N+](C)(C)CC.CCCCCCOc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C14H32N.C13H18O3/c1-5-7-8-9-10-11-12-13-14-15(3,4)6-2;1-2-3-4-5-10-16-12-8-6-11(7-9-12)13(14)15/h5-14H2,1-4H3;6-9H,2-5,10H2,1H3,(H,14,15)/q+1;/p-1 |
| InChIKey | ZCXOXDMLPMEBDY-UHFFFAOYSA-M |
| XLogP | 6.23 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.69 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|