About 4-undec-10-enoxybenzoate
4-undec-10-enoxybenzoate (PubChem CID 7009276) has the molecular formula C18H25O3-
and a molecular weight of 289.39 g/mol. Its IUPAC name is 4-undec-10-enoxybenzoate.
Molecular Properties
| Compound Name | 4-undec-10-enoxybenzoate |
| PubChem CID | 7009276 |
| Molecular Formula | C18H25O3- |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 4-undec-10-enoxybenzoate |
| SMILES | C=CCCCCCCCCCOc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C18H26O3/c1-2-3-4-5-6-7-8-9-10-15-21-17-13-11-16(12-14-17)18(19)20/h2,11-14H,1,3-10,15H2,(H,19,20)/p-1 |
| InChIKey | AWUMMWYGOIPYOJ-UHFFFAOYSA-M |
| XLogP | 3.74 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-undec-10-enoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-undec-10-enoxybenzoate?
The IUPAC name of 4-undec-10-enoxybenzoate (CID 7009276) is 4-undec-10-enoxybenzoate.
What is the SMILES notation for 4-undec-10-enoxybenzoate?
The canonical SMILES for 4-undec-10-enoxybenzoate is C=CCCCCCCCCCOc1ccc(C(=O)[O-])cc1.
What is the InChIKey of 4-undec-10-enoxybenzoate?
The InChIKey is AWUMMWYGOIPYOJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H26O3/c1-2-3-4-5-6-7-8-9-10-15-21-17-13-11-16(12-14-17)18(19)20/h2,11-14H,1,3-10,15H2,(H,19,20)/p-1.
What are the key properties of 4-undec-10-enoxybenzoate?
4-undec-10-enoxybenzoate has a molecular weight of 289.39 g/mol, XLogP of 3.74, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-undec-10-enoxybenzoate is sourced from PubChem (CID 7009276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).