C10H10FeO6 — CID 174939039
ethane-1,2-diol;iron(2+);terephthalate (PubChem CID 174939039) has the molecular formula C10H10FeO6 and a molecular weight of 282.03 g/mol. Its IUPAC name is ethane-1,2-diol;iron(2+);terephthalate.
| Compound Name | ethane-1,2-diol;iron(2+);terephthalate |
|---|---|
| PubChem CID | 174939039 |
| Molecular Formula | C10H10FeO6 |
| Molecular Weight | 282.03 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | ethane-1,2-diol;iron(2+);terephthalate |
| SMILES | O=C([O-])c1ccc(C(=O)[O-])cc1.OCCO.[Fe+2] |
| InChI | InChI=1S/C8H6O4.C2H6O2.Fe/c9-7(10)5-1-2-6(4-3-5)8(11)12;3-1-2-4;/h1-4H,(H,9,10)(H,11,12);3-4H,1-2H2;/q;;+2/p-2 |
| InChIKey | IDZIZNYFBMICCS-UHFFFAOYSA-L |
| XLogP | -2.62 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.03 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|