About cesium 4-hydroxybenzoate
cesium 4-hydroxybenzoate (PubChem CID 162003528) has the molecular formula C7H5CsO3
and a molecular weight of 270.02 g/mol. Its IUPAC name is cesium 4-hydroxybenzoate.
Molecular Properties
| Compound Name | cesium 4-hydroxybenzoate |
| PubChem CID | 162003528 |
| Molecular Formula | C7H5CsO3 |
| Molecular Weight | 270.02 g/mol |
| Exact Mass | 269.93 |
| IUPAC Name | cesium 4-hydroxybenzoate |
| SMILES | O=C([O-])c1ccc(O)cc1.[Cs+] |
| InChI | InChI=1S/C7H6O3.Cs/c8-6-3-1-5(2-4-6)7(9)10;/h1-4,8H,(H,9,10);/q;+1/p-1 |
| InChIKey | YSNIUZVLBHPNKV-UHFFFAOYSA-M |
| XLogP | -3.24 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.02 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cesium 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium 4-hydroxybenzoate?
The IUPAC name of cesium 4-hydroxybenzoate (CID 162003528) is cesium 4-hydroxybenzoate.
What is the SMILES notation for cesium 4-hydroxybenzoate?
The canonical SMILES for cesium 4-hydroxybenzoate is O=C([O-])c1ccc(O)cc1.[Cs+].
What is the InChIKey of cesium 4-hydroxybenzoate?
The InChIKey is YSNIUZVLBHPNKV-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6O3.Cs/c8-6-3-1-5(2-4-6)7(9)10;/h1-4,8H,(H,9,10);/q;+1/p-1.
What are the key properties of cesium 4-hydroxybenzoate?
cesium 4-hydroxybenzoate has a molecular weight of 270.02 g/mol, XLogP of -3.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cesium 4-hydroxybenzoate is sourced from PubChem (CID 162003528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).