About calcium;4-hydroxybenzoate;octane
calcium;4-hydroxybenzoate;octane (PubChem CID 163406027) has the molecular formula C15H22CaO3
and a molecular weight of 290.42 g/mol. Its IUPAC name is calcium;4-hydroxybenzoate;octane.
Molecular Properties
| Compound Name | calcium;4-hydroxybenzoate;octane |
| PubChem CID | 163406027 |
| Molecular Formula | C15H22CaO3 |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | calcium;4-hydroxybenzoate;octane |
| SMILES | O=C([O-])c1ccc(O)cc1.[CH2-]CCCCCCC.[Ca+2] |
| InChI | InChI=1S/C8H17.C7H6O3.Ca/c1-3-5-7-8-6-4-2;8-6-3-1-5(2-4-6)7(9)10;/h1,3-8H2,2H3;1-4,8H,(H,9,10);/q-1;;+2/p-1 |
| InChIKey | QNXOJOGTRNBKST-UHFFFAOYSA-M |
| XLogP | 2.56 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze calcium;4-hydroxybenzoate;octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;4-hydroxybenzoate;octane?
The IUPAC name of calcium;4-hydroxybenzoate;octane (CID 163406027) is calcium;4-hydroxybenzoate;octane.
What is the SMILES notation for calcium;4-hydroxybenzoate;octane?
The canonical SMILES for calcium;4-hydroxybenzoate;octane is O=C([O-])c1ccc(O)cc1.[CH2-]CCCCCCC.[Ca+2].
What is the InChIKey of calcium;4-hydroxybenzoate;octane?
The InChIKey is QNXOJOGTRNBKST-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H17.C7H6O3.Ca/c1-3-5-7-8-6-4-2;8-6-3-1-5(2-4-6)7(9)10;/h1,3-8H2,2H3;1-4,8H,(H,9,10);/q-1;;+2/p-1.
What are the key properties of calcium;4-hydroxybenzoate;octane?
calcium;4-hydroxybenzoate;octane has a molecular weight of 290.42 g/mol, XLogP of 2.56, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;4-hydroxybenzoate;octane is sourced from PubChem (CID 163406027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).