C30H50N2O6S+2 — CID 67781976
4-(4-carboxyphenyl)sulfonylbenzoic acid;bis(tetraethylazanium) (PubChem CID 67781976) has the molecular formula C30H50N2O6S+2 and a molecular weight of 566.81 g/mol. Its IUPAC name is 4-(4-carboxyphenyl)sulfonylbenzoic acid;bis(tetraethylazanium).
| Compound Name | 4-(4-carboxyphenyl)sulfonylbenzoic acid;bis(tetraethylazanium) |
|---|---|
| PubChem CID | 67781976 |
| Molecular Formula | C30H50N2O6S+2 |
| Molecular Weight | 566.81 g/mol |
| Exact Mass | 566.34 |
| IUPAC Name | 4-(4-carboxyphenyl)sulfonylbenzoic acid;bis(tetraethylazanium) |
| SMILES | CC[N+](CC)(CC)CC.CC[N+](CC)(CC)CC.O=C(O)c1ccc(S(=O)(=O)c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C14H10O6S.2C8H20N/c15-13(16)9-1-5-11(6-2-9)21(19,20)12-7-3-10(4-8-12)14(17)18;2*1-5-9(6-2,7-3)8-4/h1-8H,(H,15,16)(H,17,18);2*5-8H2,1-4H3/q;2*+1 |
| InChIKey | ZRHJKJRPWSGAEI-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.81 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|