C16H17O7PS — CID 87175689
4-[4-[[ethoxy(hydroxy)phosphoryl]methyl]phenyl]sulfonylbenzoic acid (PubChem CID 87175689) has the molecular formula C16H17O7PS and a molecular weight of 384.35 g/mol. Its IUPAC name is 4-[4-[[ethoxy(hydroxy)phosphoryl]methyl]phenyl]sulfonylbenzoic acid.
| Compound Name | 4-[4-[[ethoxy(hydroxy)phosphoryl]methyl]phenyl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 87175689 |
| Molecular Formula | C16H17O7PS |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 4-[4-[[ethoxy(hydroxy)phosphoryl]methyl]phenyl]sulfonylbenzoic acid |
| SMILES | CCOP(=O)(O)Cc1ccc(S(=O)(=O)c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C16H17O7PS/c1-2-23-24(19,20)11-12-3-7-14(8-4-12)25(21,22)15-9-5-13(6-10-15)16(17)18/h3-10H,2,11H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | XVKPLYDKLPGUIL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|