C17H21O5P — CID 87671559
ethoxy-[[4-[[4-(hydroxymethoxy)phenyl]methyl]phenyl]methyl]phosphinic acid (PubChem CID 87671559) has the molecular formula C17H21O5P and a molecular weight of 336.32 g/mol. Its IUPAC name is ethoxy-[[4-[[4-(hydroxymethoxy)phenyl]methyl]phenyl]methyl]phosphinic acid.
| Compound Name | ethoxy-[[4-[[4-(hydroxymethoxy)phenyl]methyl]phenyl]methyl]phosphinic acid |
|---|---|
| PubChem CID | 87671559 |
| Molecular Formula | C17H21O5P |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | ethoxy-[[4-[[4-(hydroxymethoxy)phenyl]methyl]phenyl]methyl]phosphinic acid |
| SMILES | CCOP(=O)(O)Cc1ccc(Cc2ccc(OCO)cc2)cc1 |
| InChI | InChI=1S/C17H21O5P/c1-2-22-23(19,20)12-16-5-3-14(4-6-16)11-15-7-9-17(10-8-15)21-13-18/h3-10,18H,2,11-13H2,1H3,(H,19,20) |
| InChIKey | CPOIBAYCHWYIFK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|