C20H27O3P — CID 87175618
[4-[(4-butylphenyl)methyl]phenyl]methyl-ethoxyphosphinic acid (PubChem CID 87175618) has the molecular formula C20H27O3P and a molecular weight of 346.41 g/mol. Its IUPAC name is [4-[(4-butylphenyl)methyl]phenyl]methyl-ethoxyphosphinic acid.
| Compound Name | [4-[(4-butylphenyl)methyl]phenyl]methyl-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 87175618 |
| Molecular Formula | C20H27O3P |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | [4-[(4-butylphenyl)methyl]phenyl]methyl-ethoxyphosphinic acid |
| SMILES | CCCCc1ccc(Cc2ccc(CP(=O)(O)OCC)cc2)cc1 |
| InChI | InChI=1S/C20H27O3P/c1-3-5-6-17-7-9-18(10-8-17)15-19-11-13-20(14-12-19)16-24(21,22)23-4-2/h7-14H,3-6,15-16H2,1-2H3,(H,21,22) |
| InChIKey | MEIKLVLBWBGUPF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|