C17H29O4P — CID 56611232
(3,5-dibutyl-4-hydroxyphenyl)methyl-ethoxyphosphinic acid (PubChem CID 56611232) has the molecular formula C17H29O4P and a molecular weight of 328.39 g/mol. Its IUPAC name is (3,5-dibutyl-4-hydroxyphenyl)methyl-ethoxyphosphinic acid.
| Compound Name | (3,5-dibutyl-4-hydroxyphenyl)methyl-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 56611232 |
| Molecular Formula | C17H29O4P |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (3,5-dibutyl-4-hydroxyphenyl)methyl-ethoxyphosphinic acid |
| SMILES | CCCCc1cc(CP(=O)(O)OCC)cc(CCCC)c1O |
| InChI | InChI=1S/C17H29O4P/c1-4-7-9-15-11-14(13-22(19,20)21-6-3)12-16(17(15)18)10-8-5-2/h11-12,18H,4-10,13H2,1-3H3,(H,19,20) |
| InChIKey | NNSWDIQMMATPKM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|