C14H15O7PS — CID 69044867
[4-[4-(hydroxymethoxy)phenyl]sulfonylphenyl]methylphosphonic acid (PubChem CID 69044867) has the molecular formula C14H15O7PS and a molecular weight of 358.31 g/mol. Its IUPAC name is [4-[4-(hydroxymethoxy)phenyl]sulfonylphenyl]methylphosphonic acid.
| Compound Name | [4-[4-(hydroxymethoxy)phenyl]sulfonylphenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 69044867 |
| Molecular Formula | C14H15O7PS |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | [4-[4-(hydroxymethoxy)phenyl]sulfonylphenyl]methylphosphonic acid |
| SMILES | O=P(O)(O)Cc1ccc(S(=O)(=O)c2ccc(OCO)cc2)cc1 |
| InChI | InChI=1S/C14H15O7PS/c15-10-21-12-3-7-14(8-4-12)23(19,20)13-5-1-11(2-6-13)9-22(16,17)18/h1-8,15H,9-10H2,(H2,16,17,18) |
| InChIKey | FPIZQGYAASBQJA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|