C20H27O5P — CID 141142563
4-(diethoxyphosphorylmethyl)-2-[(4-ethoxyphenyl)methyl]phenol (PubChem CID 141142563) has the molecular formula C20H27O5P and a molecular weight of 378.41 g/mol. Its IUPAC name is 4-(diethoxyphosphorylmethyl)-2-[(4-ethoxyphenyl)methyl]phenol.
| Compound Name | 4-(diethoxyphosphorylmethyl)-2-[(4-ethoxyphenyl)methyl]phenol |
|---|---|
| PubChem CID | 141142563 |
| Molecular Formula | C20H27O5P |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 4-(diethoxyphosphorylmethyl)-2-[(4-ethoxyphenyl)methyl]phenol |
| SMILES | CCOc1ccc(Cc2cc(CP(=O)(OCC)OCC)ccc2O)cc1 |
| InChI | InChI=1S/C20H27O5P/c1-4-23-19-10-7-16(8-11-19)13-18-14-17(9-12-20(18)21)15-26(22,24-5-2)25-6-3/h7-12,14,21H,4-6,13,15H2,1-3H3 |
| InChIKey | MDBJRKXOFFCBIQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|