C27H32FO5P — CID 90747684
4-[[4-(diethoxyphosphorylmethoxy)-2,6-dimethylphenyl]methyl]-2-[(4-fluorophenyl)methyl]phenol (PubChem CID 90747684) has the molecular formula C27H32FO5P and a molecular weight of 486.52 g/mol. Its IUPAC name is 4-[[4-(diethoxyphosphorylmethoxy)-2,6-dimethylphenyl]methyl]-2-[(4-fluorophenyl)methyl]phenol.
| Compound Name | 4-[[4-(diethoxyphosphorylmethoxy)-2,6-dimethylphenyl]methyl]-2-[(4-fluorophenyl)methyl]phenol |
|---|---|
| PubChem CID | 90747684 |
| Molecular Formula | C27H32FO5P |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 4-[[4-(diethoxyphosphorylmethoxy)-2,6-dimethylphenyl]methyl]-2-[(4-fluorophenyl)methyl]phenol |
| SMILES | CCOP(=O)(COc1cc(C)c(Cc2ccc(O)c(Cc3ccc(F)cc3)c2)c(C)c1)OCC |
| InChI | InChI=1S/C27H32FO5P/c1-5-32-34(30,33-6-2)18-31-25-13-19(3)26(20(4)14-25)17-22-9-12-27(29)23(16-22)15-21-7-10-24(28)11-8-21/h7-14,16,29H,5-6,15,17-18H2,1-4H3 |
| InChIKey | TZGUFZXYKCBENY-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|