C17H21O5P — CID 25150124
[4-[(4-hydroxy-3-methylphenyl)methyl]-3,5-dimethylphenoxy]methylphosphonic acid (PubChem CID 25150124) has the molecular formula C17H21O5P and a molecular weight of 336.32 g/mol. Its IUPAC name is [4-[(4-hydroxy-3-methylphenyl)methyl]-3,5-dimethylphenoxy]methylphosphonic acid.
| Compound Name | [4-[(4-hydroxy-3-methylphenyl)methyl]-3,5-dimethylphenoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 25150124 |
| Molecular Formula | C17H21O5P |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | [4-[(4-hydroxy-3-methylphenyl)methyl]-3,5-dimethylphenoxy]methylphosphonic acid |
| SMILES | Cc1cc(Cc2c(C)cc(OCP(=O)(O)O)cc2C)ccc1O |
| InChI | InChI=1S/C17H21O5P/c1-11-7-15(22-10-23(19,20)21)8-12(2)16(11)9-14-4-5-17(18)13(3)6-14/h4-8,18H,9-10H2,1-3H3,(H2,19,20,21) |
| InChIKey | OYZZBRHSILKBDZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|