C18H25BrNO5P — CID 162316368
[4-[[3-(dimethylamino)-4-hydroxyphenyl]methyl]-3,5-dimethylphenoxy]methylphosphonic acid;hydrobromide (PubChem CID 162316368) has the molecular formula C18H25BrNO5P and a molecular weight of 446.28 g/mol. Its IUPAC name is [4-[[3-(dimethylamino)-4-hydroxyphenyl]methyl]-3,5-dimethylphenoxy]methylphosphonic acid;hydrobromide.
| Compound Name | [4-[[3-(dimethylamino)-4-hydroxyphenyl]methyl]-3,5-dimethylphenoxy]methylphosphonic acid;hydrobromide |
|---|---|
| PubChem CID | 162316368 |
| Molecular Formula | C18H25BrNO5P |
| Molecular Weight | 446.28 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | [4-[[3-(dimethylamino)-4-hydroxyphenyl]methyl]-3,5-dimethylphenoxy]methylphosphonic acid;hydrobromide |
| SMILES | Br.Cc1cc(OCP(=O)(O)O)cc(C)c1Cc1ccc(O)c(N(C)C)c1 |
| InChI | InChI=1S/C18H24NO5P.BrH/c1-12-7-15(24-11-25(21,22)23)8-13(2)16(12)9-14-5-6-18(20)17(10-14)19(3)4;/h5-8,10,20H,9,11H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | FNJBMTILQPUZQP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|