C21H30FO4P — CID 143340369
ethane;[4-[(4-fluoro-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenoxy]methylphosphonic acid (PubChem CID 143340369) has the molecular formula C21H30FO4P and a molecular weight of 396.44 g/mol. Its IUPAC name is ethane;[4-[(4-fluoro-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenoxy]methylphosphonic acid.
| Compound Name | ethane;[4-[(4-fluoro-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 143340369 |
| Molecular Formula | C21H30FO4P |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | ethane;[4-[(4-fluoro-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenoxy]methylphosphonic acid |
| SMILES | CC.Cc1cc(OCP(=O)(O)O)cc(C)c1Cc1ccc(F)c(C(C)C)c1 |
| InChI | InChI=1S/C19H24FO4P.C2H6/c1-12(2)17-9-15(5-6-19(17)20)10-18-13(3)7-16(8-14(18)4)24-11-25(21,22)23;1-2/h5-9,12H,10-11H2,1-4H3,(H2,21,22,23);1-2H3 |
| InChIKey | JBYDDUNTAIRSET-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|