C38H44F2O5P+ — CID 68960039
bis[[4-[(4-fluoro-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenoxy]methoxy]-oxophosphanium (PubChem CID 68960039) has the molecular formula C38H44F2O5P+ and a molecular weight of 649.74 g/mol. Its IUPAC name is bis[[4-[(4-fluoro-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenoxy]methoxy]-oxophosphanium.
| Compound Name | bis[[4-[(4-fluoro-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenoxy]methoxy]-oxophosphanium |
|---|---|
| PubChem CID | 68960039 |
| Molecular Formula | C38H44F2O5P+ |
| Molecular Weight | 649.74 g/mol |
| Exact Mass | 649.29 |
| IUPAC Name | bis[[4-[(4-fluoro-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenoxy]methoxy]-oxophosphanium |
| SMILES | Cc1cc(OCO[P+](=O)OCOc2cc(C)c(Cc3ccc(F)c(C(C)C)c3)c(C)c2)cc(C)c1Cc1ccc(F)c(C(C)C)c1 |
| InChI | InChI=1S/C38H44F2O5P/c1-23(2)33-17-29(9-11-37(33)39)19-35-25(5)13-31(14-26(35)6)42-21-44-46(41)45-22-43-32-15-27(7)36(28(8)16-32)20-30-10-12-38(40)34(18-30)24(3)4/h9-18,23-24H,19-22H2,1-8H3/q+1 |
| InChIKey | WAWZYVLUVBQOAW-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.74 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|