C24H34FO4P — CID 87087405
2-diethoxyphosphoryl-1-[4-[(4-fluoro-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenyl]ethanol (PubChem CID 87087405) has the molecular formula C24H34FO4P and a molecular weight of 436.50 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-1-[4-[(4-fluoro-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenyl]ethanol.
| Compound Name | 2-diethoxyphosphoryl-1-[4-[(4-fluoro-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenyl]ethanol |
|---|---|
| PubChem CID | 87087405 |
| Molecular Formula | C24H34FO4P |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 2-diethoxyphosphoryl-1-[4-[(4-fluoro-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenyl]ethanol |
| SMILES | CCOP(=O)(CC(O)c1cc(C)c(Cc2ccc(F)c(C(C)C)c2)c(C)c1)OCC |
| InChI | InChI=1S/C24H34FO4P/c1-7-28-30(27,29-8-2)15-24(26)20-11-17(5)22(18(6)12-20)14-19-9-10-23(25)21(13-19)16(3)4/h9-13,16,24,26H,7-8,14-15H2,1-6H3 |
| InChIKey | MWOGBAXJNNOUBO-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|