C24H36NO6PS — CID 66642924
3-[4-[[4-(methanesulfonamido)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]pentan-3-ylphosphonic acid (PubChem CID 66642924) has the molecular formula C24H36NO6PS and a molecular weight of 497.59 g/mol. Its IUPAC name is 3-[4-[[4-(methanesulfonamido)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]pentan-3-ylphosphonic acid.
| Compound Name | 3-[4-[[4-(methanesulfonamido)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]pentan-3-ylphosphonic acid |
|---|---|
| PubChem CID | 66642924 |
| Molecular Formula | C24H36NO6PS |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 3-[4-[[4-(methanesulfonamido)-3-propan-2-ylphenyl]methyl]-3,5-dimethylphenoxy]pentan-3-ylphosphonic acid |
| SMILES | CCC(CC)(Oc1cc(C)c(Cc2ccc(NS(C)(=O)=O)c(C(C)C)c2)c(C)c1)P(=O)(O)O |
| InChI | InChI=1S/C24H36NO6PS/c1-8-24(9-2,32(26,27)28)31-20-12-17(5)22(18(6)13-20)15-19-10-11-23(25-33(7,29)30)21(14-19)16(3)4/h10-14,16,25H,8-9,15H2,1-7H3,(H2,26,27,28) |
| InChIKey | WVXFRZQDUWBCBA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|