C46H64N2O13PS2+ — CID 87635083
bis[3-[4-[[3-(methanesulfonamido)-4-(methoxymethoxy)phenyl]methyl]-3,5-dimethylphenoxy]pentan-3-yloxy]-oxophosphanium (PubChem CID 87635083) has the molecular formula C46H64N2O13PS2+ and a molecular weight of 948.13 g/mol. Its IUPAC name is bis[3-[4-[[3-(methanesulfonamido)-4-(methoxymethoxy)phenyl]methyl]-3,5-dimethylphenoxy]pentan-3-yloxy]-oxophosphanium.
| Compound Name | bis[3-[4-[[3-(methanesulfonamido)-4-(methoxymethoxy)phenyl]methyl]-3,5-dimethylphenoxy]pentan-3-yloxy]-oxophosphanium |
|---|---|
| PubChem CID | 87635083 |
| Molecular Formula | C46H64N2O13PS2+ |
| Molecular Weight | 948.13 g/mol |
| Exact Mass | 947.36 |
| IUPAC Name | bis[3-[4-[[3-(methanesulfonamido)-4-(methoxymethoxy)phenyl]methyl]-3,5-dimethylphenoxy]pentan-3-yloxy]-oxophosphanium |
| SMILES | CCC(CC)(Oc1cc(C)c(Cc2ccc(OCOC)c(NS(C)(=O)=O)c2)c(C)c1)O[P+](=O)OC(CC)(CC)Oc1cc(C)c(Cc2ccc(OCOC)c(NS(C)(=O)=O)c2)c(C)c1 |
| InChI | InChI=1S/C46H64N2O13PS2/c1-13-45(14-2,58-37-21-31(5)39(32(6)22-37)25-35-17-19-43(56-29-54-9)41(27-35)47-63(11,50)51)60-62(49)61-46(15-3,16-4)59-38-23-33(7)40(34(8)24-38)26-36-18-20-44(57-30-55-10)42(28-36)48-64(12,52)53/h17-24,27-28,47-48H,13-16,25-26,29-30H2,1-12H3/q+1 |
| InChIKey | MAEBSAKMXGMMAC-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 183.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.13 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|