C23H33O6PS — CID 66642918
3-[4-[[4-(methoxymethoxy)-3-methylsulfanylphenyl]methyl]-3,5-dimethylphenoxy]pentan-3-ylphosphonic acid (PubChem CID 66642918) has the molecular formula C23H33O6PS and a molecular weight of 468.55 g/mol. Its IUPAC name is 3-[4-[[4-(methoxymethoxy)-3-methylsulfanylphenyl]methyl]-3,5-dimethylphenoxy]pentan-3-ylphosphonic acid.
| Compound Name | 3-[4-[[4-(methoxymethoxy)-3-methylsulfanylphenyl]methyl]-3,5-dimethylphenoxy]pentan-3-ylphosphonic acid |
|---|---|
| PubChem CID | 66642918 |
| Molecular Formula | C23H33O6PS |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 3-[4-[[4-(methoxymethoxy)-3-methylsulfanylphenyl]methyl]-3,5-dimethylphenoxy]pentan-3-ylphosphonic acid |
| SMILES | CCC(CC)(Oc1cc(C)c(Cc2ccc(OCOC)c(SC)c2)c(C)c1)P(=O)(O)O |
| InChI | InChI=1S/C23H33O6PS/c1-7-23(8-2,30(24,25)26)29-19-11-16(3)20(17(4)12-19)13-18-9-10-21(28-15-27-5)22(14-18)31-6/h9-12,14H,7-8,13,15H2,1-6H3,(H2,24,25,26) |
| InChIKey | XWJWHERRRSJYFV-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|