C20H25F2O5P — CID 143340161
[[4-[(3-butan-2-yl-4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]-difluoromethyl]phosphonic acid (PubChem CID 143340161) has the molecular formula C20H25F2O5P and a molecular weight of 414.39 g/mol. Its IUPAC name is [[4-[(3-butan-2-yl-4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]-difluoromethyl]phosphonic acid.
| Compound Name | [[4-[(3-butan-2-yl-4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 143340161 |
| Molecular Formula | C20H25F2O5P |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | [[4-[(3-butan-2-yl-4-hydroxyphenyl)methyl]-3,5-dimethylphenoxy]-difluoromethyl]phosphonic acid |
| SMILES | CCC(C)c1cc(Cc2c(C)cc(OC(F)(F)P(=O)(O)O)cc2C)ccc1O |
| InChI | InChI=1S/C20H25F2O5P/c1-5-12(2)18-11-15(6-7-19(18)23)10-17-13(3)8-16(9-14(17)4)27-20(21,22)28(24,25)26/h6-9,11-12,23H,5,10H2,1-4H3,(H2,24,25,26) |
| InChIKey | FKPXNQJLVNOQLL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|