C19H23Cl2O3P — CID 162464815
4-[[4-(dichlorophosphorylmethoxy)-2,6-dimethylphenyl]methyl]-2-propan-2-ylphenol (PubChem CID 162464815) has the molecular formula C19H23Cl2O3P and a molecular weight of 401.27 g/mol. Its IUPAC name is 4-[[4-(dichlorophosphorylmethoxy)-2,6-dimethylphenyl]methyl]-2-propan-2-ylphenol.
| Compound Name | 4-[[4-(dichlorophosphorylmethoxy)-2,6-dimethylphenyl]methyl]-2-propan-2-ylphenol |
|---|---|
| PubChem CID | 162464815 |
| Molecular Formula | C19H23Cl2O3P |
| Molecular Weight | 401.27 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 4-[[4-(dichlorophosphorylmethoxy)-2,6-dimethylphenyl]methyl]-2-propan-2-ylphenol |
| SMILES | Cc1cc(OCP(=O)(Cl)Cl)cc(C)c1Cc1ccc(O)c(C(C)C)c1 |
| InChI | InChI=1S/C19H23Cl2O3P/c1-12(2)17-9-15(5-6-19(17)22)10-18-13(3)7-16(8-14(18)4)24-11-25(20,21)23/h5-9,12,22H,10-11H2,1-4H3 |
| InChIKey | CMANUCBVACGRJH-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.27 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|