C19H25O6PS — CID 15942558
[4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenyl]sulfonylmethylphosphonic acid (PubChem CID 15942558) has the molecular formula C19H25O6PS and a molecular weight of 412.44 g/mol. Its IUPAC name is [4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenyl]sulfonylmethylphosphonic acid.
| Compound Name | [4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenyl]sulfonylmethylphosphonic acid |
|---|---|
| PubChem CID | 15942558 |
| Molecular Formula | C19H25O6PS |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | [4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenyl]sulfonylmethylphosphonic acid |
| SMILES | Cc1cc(S(=O)(=O)CP(=O)(O)O)cc(C)c1Cc1ccc(O)c(C(C)C)c1 |
| InChI | InChI=1S/C19H25O6PS/c1-12(2)17-9-15(5-6-19(17)20)10-18-13(3)7-16(8-14(18)4)27(24,25)11-26(21,22)23/h5-9,12,20H,10-11H2,1-4H3,(H2,21,22,23) |
| InChIKey | DARPFFXHFPIGIR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|