C33H52N3O5P — CID 68534477
N,N-bis[(2,4-dimethyl-3-oxopentan-2-yl)amino]-[[4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenyl]methyl]phosphonamidic acid (PubChem CID 68534477) has the molecular formula C33H52N3O5P and a molecular weight of 601.77 g/mol. Its IUPAC name is N,N-bis[(2,4-dimethyl-3-oxopentan-2-yl)amino]-[[4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenyl]methyl]phosphonamidic acid.
| Compound Name | N,N-bis[(2,4-dimethyl-3-oxopentan-2-yl)amino]-[[4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenyl]methyl]phosphonamidic acid |
|---|---|
| PubChem CID | 68534477 |
| Molecular Formula | C33H52N3O5P |
| Molecular Weight | 601.77 g/mol |
| Exact Mass | 601.36 |
| IUPAC Name | N,N-bis[(2,4-dimethyl-3-oxopentan-2-yl)amino]-[[4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenyl]methyl]phosphonamidic acid |
| SMILES | Cc1cc(CP(=O)(O)N(NC(C)(C)C(=O)C(C)C)NC(C)(C)C(=O)C(C)C)cc(C)c1Cc1ccc(O)c(C(C)C)c1 |
| InChI | InChI=1S/C33H52N3O5P/c1-20(2)27-17-25(13-14-29(27)37)18-28-23(7)15-26(16-24(28)8)19-42(40,41)36(34-32(9,10)30(38)21(3)4)35-33(11,12)31(39)22(5)6/h13-17,20-22,34-35,37H,18-19H2,1-12H3,(H,40,41) |
| InChIKey | BJMSZRAKYGGKFJ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.77 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|